Fluconazole CAS#86386-73-4
Broad-Spectrum Antifungal Activity: Fluconazole offers effective systemic antifungal treatment, making it highly versatile for various fungal infections due to its broad-spectrum activity.
Selective Enzyme Inhibition: It selectively inhibits fungal cytochrome P-450-dependent enzymes, essential for fungal cell membrane synthesis, enhancing its antifungal efficacy.
Potent Inhibition of Alcohol Synthesis: Fluconazole also inhibits fungal alcohol synthesis, further increasing its antifungal properties and providing a potent defense against infections.
High Specificity and Trust: Known for its high specificity and effectiveness, fluconazole has become a widely trusted option for treating various fungal infections, ensuring reliable results in clinical use.
Fluconazole is a new triazole antifungal drug that was first developed by Pfizer Pharmaceuticals in the United States. It is known for its broad-spectrum antifungal effect, making it an effective systemic antifungal treatment. The drug works by selectively inhibiting fungal cytochrome P-450-dependent enzymes, which are crucial for the synthesis of fungal cell membranes.
Additionally, fluconazole acts as a potent and specific inhibitor of fungal alcohol synthesis, further enhancing its antifungal properties. Its high specificity and effectiveness have made it a widely used and trusted option for treating various fungal infections.
Parameters
Melting point | 138-140°C |
Boiling point | 579.8±60.0 °C(Predicted) |
density | 1.05 |
Fp | 9℃ |
storage temp. | 2-8°C |
solubility | DMSO: 5 mg/mL |
form | solid |
pka | pKa 1.76±0.1(H2O t=24 I=0.1(NaCl)) (Uncertain) |
color | White to Off-White |
Water Solubility | 1g/L(temperature not stated) |
Merck | 144122 |
BCS Class | 1,3 |
InChI | InChI=1S/C13H12F2N6O/c14-10-1-2-11(12(15)3-10)13(22,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-3,6-9,22H,4-5H2 |
InChIKey | RFHAOTPXVQNOHP-UHFFFAOYSA-N |
SMILES | C1(C=CC(F)=CC=1F)C(O)(CN1N=CN=C1)CN1N=CN=C1 |
CAS DataBase Reference | 86386-73-4(CAS DataBase Reference) |
Safety Information Hazard Codes | Xn,Xi,T,F |
Risk Statements | 22-36/37/38-20/21/22-39/23/24/25-23/24/25-11 |
Safety Statements | 26-36-36/37/39-24/25-45-36/37-16-7 |
RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
WGK Germany | 3 |
RTECS | XZ4810000 |
HS Code | 29336990 |
Hazardous Substances Data | 86386-73-4(Hazardous Substances Data) |




