Products Description of 3,6-Dibromopyridazide CAS#17973-86-3
3,6-Dibromopyridazine is a chemical compound with the molecular formula C4H2Br2N2 and a molecular weight of 237.88. Its CAS number is 17973-86-3. The compound has a melting point of 116–117°C, a boiling point of 327.5±22.0°C, a density of 2.2±0.1 g/cm³, a vapor pressure of 0.0±0.7 mmHg at 25°C, and a flash point of 151.9±22.3°C. It can be stored at room temperature and is primarily used as a biochemical reagent in life science research.
3,6-Dibromopyridazide CAS#17973-86-3 Chemical Properties
| Melting point | 116 °C |
| Boiling point | 327.5±22.0 °C(Predicted) |
| Density | 2?+-.0.06 g/cm3(Predicted) |
| Storage temp | Keep in dark place,Sealed in dry,Room Temperature |
| Pka | -1.18±0.10(Predicted) |
| Form | Solid |
| Color | White to pale yellow |
| InChI | InChI=1S/C4H2Br2N2/c5-3-1-2-4(6)8-7-3/h1-2H |
| InChIKey | VQAFMTSSCUETHA-UHFFFAOYSA-N |
| SMILES | C1(Br)=NN=C(Br)C=C1 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-36/37/39-22-37/39-36/37-24/25 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29339900 |
Product Application of 3,6-Dibromopyridazine CAS#17973-86-3
3,6-Dibromopyridazine is primarily used as a pharmaceutical intermediate and in organic synthesis applications. It can also be utilized as an organic solvent and applied in the production of dyes, pesticides, and fragrances.
