Thiamine chloride CAS#59-43-8
1. Essential for Carbohydrate Metabolism: Vitamin B1 is critical for converting carbohydrates into energy by acting as a coenzyme in metabolism.
2. Supports Neurological Health: It plays a key role in maintaining proper nerve function and preventing neurological disorders.
3. Promotes Cardiac Function: Thiamine helps in maintaining healthy heart function and proper circulation.
4. Improves Digestive Health: It supports digestive processes by enhancing enzyme function and nutrient absorption.
Vitamin B1, alternatively referred to as "thiamine" or "thiamine hydrochloride," represents one of the essential B-complex vitamins. This nutrient plays a crucial role in facilitating proper carbohydrate metabolism and serves as a vital component for maintaining healthy neurological transmission, cardiac function, and digestive processes. When combined with adenosine triphosphate, it forms vitamin B1 pyrophosphate (thiamine diphosphate, also known as cocarboxylase), which acts as an indispensable coenzyme in carbohydrate metabolism.
Deficiency of this coenzyme disrupts oxidative metabolism, causing accumulation of pyruvate and lactic acid, thereby compromising the body's energy production. Additionally, vitamin B1 functions as an inhibitor of cholinesterase activity. In cases of deficiency, increased cholinesterase activity accelerates acetylcholine breakdown, resulting in impaired neural signal transmission and subsequent effects on both gastrointestinal and cardiac function.
Melting point | 248 °C (decomp) |
density | 1.3175 (rough estimate) |
refractive index | 1.5630 (estimate) |
storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
solubility | DMSO : 6 mg/mL (19.95 mM) |
form | Solid |
color | White to off-white |
InChI | InChI=1S/C12H17N4OS.ClH/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H/q+1;/p-1 |
InChIKey | MYVIATVLJGTBFV-UHFFFAOYSA-M |
SMILES | O([H])CCC1=C(C)[N+](=CS1)CC1C=NC(=NC=1N)C.[Cl-] |
LogP | -3.930 (est) |
CAS DataBase Reference | 59-43-8(CAS DataBase Reference) |
EPA Substance Registry System | Thiamine (59-43-8) |
Safety Information | |
Hazardous Substances Data | 59-43-8(Hazardous Substances Data) |




