Olivetol CAS#500-66-3
Broad-Spectrum Antimicrobial Activity: Exhibits potent fungicidal and bactericidal effects against multiple pathogenic strains.
Targeted Biochemical Action: At higher concentrations, induces DNA cleavage in the presence of CuCl₂ and O₂, enabling specific biochemical mechanisms.
Therapeutic Efficacy: Demonstrates clinically observed efficacy against retroviral infections (like HIV) and various malignant tumors/cancers.
Favorable Handling Properties: Exists as a stable, colorless-to-beige solid with standard room temperature storage requirements (inert/dark).
Olivetol demonstrates diverse biological activities, exhibiting potent fungicidal and bactericidal effects against multiple pathogenic strains. Recent studies have revealed that at elevated concentrations, this 3,5-dihydroxyalkylbenzene compound can induce DNA cleavage in the presence of copper chloride and molecular oxygen.
These properties have led to its therapeutic application in combating retroviral infections, particularly human immunodeficiency viruses, as well as various malignant tumors including cancers, with clinically observed efficacy.
Parameters
Melting point | 46-48 °C(lit.) |
Boiling point | 164 °C |
density | 1.068±0.06 g/cm3(Predicted) |
Fp | >230 °F |
storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
solubility | Chloroform (Slightly), Methanol (Slightly) |
form | Solid |
pka | 9.59±0.10(Predicted) |
color | Colourless to Beige |
Stability: | Light Sensitive |
InChI | InChI=1S/C11H16O2/c1-2-3-4-5-9-6-10(12)8-11(13)7-9/h6-8,12-13H,2-5H2,1H3 |
InChIKey | IRMPFYJSHJGOPE-UHFFFAOYSA-N |
SMILES | C1(O)=CC(CCCCC)=CC(O)=C1 |
CAS DataBase Reference | 500-66-3(CAS DataBase Reference) |
NIST Chemistry Reference | 1,3-Benzenediol, 5-pentyl-(500-66-3) |
EPA Substance Registry System | Olivetol (500-66-3) |
Safety Information |
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 26-36/39 |
WGK Germany | 3 |
RTECS | VH2880000 |
HS Code | 2907290090 |
