Hyaluronic acid CAS#9004-61-9
Moisturizing Properties: Hyaluronic acid is renowned for its exceptional ability to retain water, making it the most effective natural moisturizer for skin and tissues.
Joint Lubrication: It plays a crucial role in lubricating joints, helping to reduce friction and support overall joint health.
Wound Healing: Hyaluronic acid promotes wound healing by supporting tissue regeneration and reducing inflammation.
Vessel Permeability Regulation: It helps regulate the permeability of blood vessel walls, ensuring efficient protein and nutrient diffusion.
Hyaluronic acid is an acidic mucopolysaccharide with a distinctive molecular structure, which imparts unique physical and chemical properties. It serves several vital physiological functions in the body, including lubricating joints, regulating the permeability of blood vessel walls, controlling the diffusion and action of proteins and hydrolyzates, and promoting wound healing.
Notably, hyaluronic acid has a remarkable water-retaining capability, making it the most effective moisturizing substance discovered in nature to date. As a result, it is widely recognized as an ideal natural moisturizing factor, benefiting both skin and internal tissues.
Parameters
storage temp. | −20°C |
solubility | H2O: 5 mg/mL, clear, colorless |
form | Lyophilized Powder |
color | White |
Odor | Odorless |
optical activity | -70~-80 |
Water Solubility | Soluble in water. |
InChIKey | MAKUBRYLFHZREJ-IUPJJCKZNA-M |
SMILES | [C@@H]1(O[C@H]2[C@H](O)[C@H]([C@H](O)O[C@@H]2C(=O)[O-])O)O[C@H](CO)[C@@H](O)C[C@H]1NC(=O)C.[Na+] |&1:0,2,3,5,6,9,15,18,21,r| |
LogP | -6.623 (est) |
CAS DataBase Reference | 9004-61-9 |
EPA Substance Registry System | Hyaluronic acid (9004-61-9) |
Safety Information | |
Hazard Codes | B |
Safety Statements | 22-24/25 |
WGK Germany | 3 |
RTECS | MT7250000 |
F | 45726 |
TSCA | Yes |
Hazardous Substances Data | 9004-61-9(Hazardous Substances Data) |




